C21H30N6O12 — CID 67194953
methyl 2-[[4,6-bis[bis(2-methoxy-2-oxoethyl)amino]-1,3,5-triazin-2-yl]-(2-methoxy-2-oxoethyl)amino]acetate (PubChem CID 67194953) has the molecular formula C21H30N6O12 and a molecular weight of 558.50 g/mol. Its IUPAC name is methyl 2-[[4,6-bis[bis(2-methoxy-2-oxoethyl)amino]-1,3,5-triazin-2-yl]-(2-methoxy-2-oxoethyl)amino]acetate.
| Compound Name | methyl 2-[[4,6-bis[bis(2-methoxy-2-oxoethyl)amino]-1,3,5-triazin-2-yl]-(2-methoxy-2-oxoethyl)amino]acetate |
|---|---|
| PubChem CID | 67194953 |
| Molecular Formula | C21H30N6O12 |
| Molecular Weight | 558.50 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | methyl 2-[[4,6-bis[bis(2-methoxy-2-oxoethyl)amino]-1,3,5-triazin-2-yl]-(2-methoxy-2-oxoethyl)amino]acetate |
| SMILES | COC(=O)CN(CC(=O)OC)c1nc(N(CC(=O)OC)CC(=O)OC)nc(N(CC(=O)OC)CC(=O)OC)n1 |
| InChI | InChI=1S/C21H30N6O12/c1-34-13(28)7-25(8-14(29)35-2)19-22-20(26(9-15(30)36-3)10-16(31)37-4)24-21(23-19)27(11-17(32)38-5)12-18(33)39-6/h7-12H2,1-6H3 |
| InChIKey | OGBRLRKKGVQKOW-UHFFFAOYSA-N |
| XLogP | -2.67 |
| TPSA | 206.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.50 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|