C2H10N6O3S — CID 67195265
azanium;1H-1,2,4-triazol-5-amine;sulfamate (PubChem CID 67195265) has the molecular formula C2H10N6O3S and a molecular weight of 198.21 g/mol. Its IUPAC name is azanium;1H-1,2,4-triazol-5-amine;sulfamate.
| Compound Name | azanium;1H-1,2,4-triazol-5-amine;sulfamate |
|---|---|
| PubChem CID | 67195265 |
| Molecular Formula | C2H10N6O3S |
| Molecular Weight | 198.21 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | azanium;1H-1,2,4-triazol-5-amine;sulfamate |
| SMILES | NS(=O)(=O)[O-].Nc1ncn[nH]1.[NH4+] |
| InChI | InChI=1S/C2H4N4.H3NO3S.H3N/c3-2-4-1-5-6-2;1-5(2,3)4;/h1H,(H3,3,4,5,6);(H3,1,2,3,4);1H3 |
| InChIKey | MEKNUGDBPPGCNP-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 187.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.21 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|