About 2-naphthalen-2-ylethenol
2-naphthalen-2-ylethenol (PubChem CID 67195423) has the molecular formula C12H10O
and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-naphthalen-2-ylethenol.
Molecular Properties
| Compound Name | 2-naphthalen-2-ylethenol |
| PubChem CID | 67195423 |
| Molecular Formula | C12H10O |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 2-naphthalen-2-ylethenol |
| SMILES | OC=Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H10O/c13-8-7-10-5-6-11-3-1-2-4-12(11)9-10/h1-9,13H |
| InChIKey | WZMAFGPKBXDWSA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-naphthalen-2-ylethenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-naphthalen-2-ylethenol?
The IUPAC name of 2-naphthalen-2-ylethenol (CID 67195423) is 2-naphthalen-2-ylethenol.
What is the SMILES notation for 2-naphthalen-2-ylethenol?
The canonical SMILES for 2-naphthalen-2-ylethenol is OC=Cc1ccc2ccccc2c1.
What is the InChIKey of 2-naphthalen-2-ylethenol?
The InChIKey is WZMAFGPKBXDWSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O/c13-8-7-10-5-6-11-3-1-2-4-12(11)9-10/h1-9,13H.
What are the key properties of 2-naphthalen-2-ylethenol?
2-naphthalen-2-ylethenol has a molecular weight of 170.21 g/mol, XLogP of 3.37, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-naphthalen-2-ylethenol is sourced from PubChem (CID 67195423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).