C36H35F3N6O5S — CID 67195681
3-(2-ethoxy-3-pyridinyl)-3-[[4-(4-methylpiperazin-1-yl)phenyl]methylamino]-2-oxo-1-[4-(2,2,2-trifluoroethoxy)phenyl]sulfonylindole-5-carbonitrile (PubChem CID 67195681) has the molecular formula C36H35F3N6O5S and a molecular weight of 720.77 g/mol. Its IUPAC name is 3-(2-ethoxy-3-pyridinyl)-3-[[4-(4-methylpiperazin-1-yl)phenyl]methylamino]-2-oxo-1-[4-(2,2,2-trifluoroethoxy)phenyl]sulfonylindole-5-carbonitrile.
| Compound Name | 3-(2-ethoxy-3-pyridinyl)-3-[[4-(4-methylpiperazin-1-yl)phenyl]methylamino]-2-oxo-1-[4-(2,2,2-trifluoroethoxy)phenyl]sulfonylindole-5-carbonitrile |
|---|---|
| PubChem CID | 67195681 |
| Molecular Formula | C36H35F3N6O5S |
| Molecular Weight | 720.77 g/mol |
| Exact Mass | 720.23 |
| IUPAC Name | 3-(2-ethoxy-3-pyridinyl)-3-[[4-(4-methylpiperazin-1-yl)phenyl]methylamino]-2-oxo-1-[4-(2,2,2-trifluoroethoxy)phenyl]sulfonylindole-5-carbonitrile |
| SMILES | CCOc1ncccc1C1(NCc2ccc(N3CCN(C)CC3)cc2)C(=O)N(S(=O)(=O)c2ccc(OCC(F)(F)F)cc2)c2ccc(C#N)cc21 |
| InChI | InChI=1S/C36H35F3N6O5S/c1-3-49-33-30(5-4-16-41-33)36(42-23-25-6-9-27(10-7-25)44-19-17-43(2)18-20-44)31-21-26(22-40)8-15-32(31)45(34(36)46)51(47,48)29-13-11-28(12-14-29)50-24-35(37,38)39/h4-16,21,42H,3,17-20,23-24H2,1-2H3 |
| InChIKey | FGCHWFMNUQCFBW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.77 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|