C23H35N3O3 — CID 67196104
N-[[(3aR,4R,6aS)-2,2-dimethyl-3a-[(3-pyrrolidin-1-ylphenyl)methyl]-4,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methyl]butanamide (PubChem CID 67196104) has the molecular formula C23H35N3O3 and a molecular weight of 401.55 g/mol. Its IUPAC name is N-[[(3aR,4R,6aS)-2,2-dimethyl-3a-[(3-pyrrolidin-1-ylphenyl)methyl]-4,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methyl]butanamide.
| Compound Name | N-[[(3aR,4R,6aS)-2,2-dimethyl-3a-[(3-pyrrolidin-1-ylphenyl)methyl]-4,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methyl]butanamide |
|---|---|
| PubChem CID | 67196104 |
| Molecular Formula | C23H35N3O3 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | N-[[(3aR,4R,6aS)-2,2-dimethyl-3a-[(3-pyrrolidin-1-ylphenyl)methyl]-4,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methyl]butanamide |
| SMILES | CCCC(=O)NC[C@H]1NC[C@@H]2OC(C)(C)O[C@@]21Cc1cccc(N2CCCC2)c1 |
| InChI | InChI=1S/C23H35N3O3/c1-4-8-21(27)25-15-19-23(20(16-24-19)28-22(2,3)29-23)14-17-9-7-10-18(13-17)26-11-5-6-12-26/h7,9-10,13,19-20,24H,4-6,8,11-12,14-16H2,1-3H3,(H,25,27)/t19-,20+,23-/m1/s1 |
| InChIKey | HTDAOEOKZBOTJY-ZRCGQRJVSA-N |
| XLogP | 2.61 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |