C29H41N4O3+ — CID 67196236
[(1S,2S)-1-acetyl-1,2-dimethyl-6-[4-[(2-pyrrolidin-1-ylethylamino)methyl]phenyl]-3,4-dihydro-2H-quinolin-1-ium-4-yl]-ethylcarbamic acid (PubChem CID 67196236) has the molecular formula C29H41N4O3+ and a molecular weight of 493.67 g/mol. Its IUPAC name is [(1S,2S)-1-acetyl-1,2-dimethyl-6-[4-[(2-pyrrolidin-1-ylethylamino)methyl]phenyl]-3,4-dihydro-2H-quinolin-1-ium-4-yl]-ethylcarbamic acid.
| Compound Name | [(1S,2S)-1-acetyl-1,2-dimethyl-6-[4-[(2-pyrrolidin-1-ylethylamino)methyl]phenyl]-3,4-dihydro-2H-quinolin-1-ium-4-yl]-ethylcarbamic acid |
|---|---|
| PubChem CID | 67196236 |
| Molecular Formula | C29H41N4O3+ |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | [(1S,2S)-1-acetyl-1,2-dimethyl-6-[4-[(2-pyrrolidin-1-ylethylamino)methyl]phenyl]-3,4-dihydro-2H-quinolin-1-ium-4-yl]-ethylcarbamic acid |
| SMILES | CCN(C(=O)O)C1C[C@H](C)[N@+](C)(C(C)=O)c2ccc(-c3ccc(CNCCN4CCCC4)cc3)cc21 |
| InChI | InChI=1S/C29H40N4O3/c1-5-32(29(35)36)27-18-21(2)33(4,22(3)34)28-13-12-25(19-26(27)28)24-10-8-23(9-11-24)20-30-14-17-31-15-6-7-16-31/h8-13,19,21,27,30H,5-7,14-18,20H2,1-4H3/p+1/t21-,27?,33+/m0/s1 |
| InChIKey | STLAZLCNKVAUDI-DOFWGBOISA-O |
| XLogP | 4.86 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|