C15H20N2OS — CID 671966
4-(4-ethoxyphenyl)-N,3-diethyl-1,3-thiazol-2-imine (PubChem CID 671966) has the molecular formula C15H20N2OS and a molecular weight of 276.41 g/mol. Its IUPAC name is 4-(4-ethoxyphenyl)-N,3-diethyl-1,3-thiazol-2-imine.
| Compound Name | 4-(4-ethoxyphenyl)-N,3-diethyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 671966 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 4-(4-ethoxyphenyl)-N,3-diethyl-1,3-thiazol-2-imine |
| SMILES | CC/N=c1\scc(-c2ccc(OCC)cc2)n1CC |
| InChI | InChI=1S/C15H20N2OS/c1-4-16-15-17(5-2)14(11-19-15)12-7-9-13(10-8-12)18-6-3/h7-11H,4-6H2,1-3H3/b16-15- |
| InChIKey | JWFHVXUOAKKKKU-NXVVXOECSA-N |
| XLogP | 3.56 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|