C16H24FNO4 — CID 67197373
2-[(1R,5S,6S)-3-(2-fluoroethyl)-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]-3,3-dimethylbutanoic acid (PubChem CID 67197373) has the molecular formula C16H24FNO4 and a molecular weight of 313.37 g/mol. Its IUPAC name is 2-[(1R,5S,6S)-3-(2-fluoroethyl)-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[(1R,5S,6S)-3-(2-fluoroethyl)-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 67197373 |
| Molecular Formula | C16H24FNO4 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 2-[(1R,5S,6S)-3-(2-fluoroethyl)-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)[C@]1(C[N+](=O)[O-])C[C@H]2CC(CCF)=C[C@H]21 |
| InChI | InChI=1S/C16H24FNO4/c1-15(2,3)13(14(19)20)16(9-18(21)22)8-11-6-10(4-5-17)7-12(11)16/h7,11-13H,4-6,8-9H2,1-3H3,(H,19,20)/t11-,12-,13?,16+/m1/s1 |
| InChIKey | WCUKOKOLBVOLER-WSRGEAPQSA-N |
| XLogP | 3.32 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|