C15H23NO4 — CID 67197400
3,3-dimethyl-2-[(1R,5R)-7-methyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]butanoic acid (PubChem CID 67197400) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 3,3-dimethyl-2-[(1R,5R)-7-methyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]butanoic acid.
| Compound Name | 3,3-dimethyl-2-[(1R,5R)-7-methyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]butanoic acid |
|---|---|
| PubChem CID | 67197400 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 3,3-dimethyl-2-[(1R,5R)-7-methyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]butanoic acid |
| SMILES | CC1[C@H]2CC=C[C@H]2C1(C[N+](=O)[O-])C(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C15H23NO4/c1-9-10-6-5-7-11(10)15(9,8-16(19)20)12(13(17)18)14(2,3)4/h5,7,9-12H,6,8H2,1-4H3,(H,17,18)/t9?,10-,11-,12?,15?/m1/s1 |
| InChIKey | RNGSNODEMKPNLC-XWFQHHMZSA-N |
| XLogP | 2.84 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|