C25H26N2O5S — CID 67197480
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-methyl-3-[(5-pyridin-2-ylthiophen-2-yl)methyl]indol-1-yl]oxane-3,4,5-triol (PubChem CID 67197480) has the molecular formula C25H26N2O5S and a molecular weight of 466.56 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-methyl-3-[(5-pyridin-2-ylthiophen-2-yl)methyl]indol-1-yl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-methyl-3-[(5-pyridin-2-ylthiophen-2-yl)methyl]indol-1-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 67197480 |
| Molecular Formula | C25H26N2O5S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-methyl-3-[(5-pyridin-2-ylthiophen-2-yl)methyl]indol-1-yl]oxane-3,4,5-triol |
| SMILES | Cc1cccc2c1c(Cc1ccc(-c3ccccn3)s1)cn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H26N2O5S/c1-14-5-4-7-18-21(14)15(11-16-8-9-20(33-16)17-6-2-3-10-26-17)12-27(18)25-24(31)23(30)22(29)19(13-28)32-25/h2-10,12,19,22-25,28-31H,11,13H2,1H3/t19-,22-,23+,24-,25-/m1/s1 |
| InChIKey | PHLVRLQCODGCHU-HYOIWIKGSA-N |
| XLogP | 2.64 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |