C25H29FN4O4S — CID 67197783
N-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]methyl]-N-(2-hydroxyethyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 67197783) has the molecular formula C25H29FN4O4S and a molecular weight of 500.60 g/mol. Its IUPAC name is N-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]methyl]-N-(2-hydroxyethyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]methyl]-N-(2-hydroxyethyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 67197783 |
| Molecular Formula | C25H29FN4O4S |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | N-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]methyl]-N-(2-hydroxyethyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)N(CCO)C[C@H]1CCC2=C1[C@@H](C)c1cnn(-c3ccc(F)cc3)c1C2 |
| InChI | InChI=1S/C25H29FN4O4S/c1-15-22-13-27-30(21-8-6-20(26)7-9-21)23(22)12-18-4-5-19(24(15)18)14-29(10-11-31)35(32,33)25-16(2)28-34-17(25)3/h6-9,13,15,19,31H,4-5,10-12,14H2,1-3H3/t15-,19+/m0/s1 |
| InChIKey | SYQCLENVBDBIDX-HNAYVOBHSA-N |
| XLogP | 3.67 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|