C17H25NO4 — CID 67197966
3,3-dimethyl-2-[(1S,5R,6S)-6-(nitromethyl)spiro[bicyclo[3.2.0]hept-3-ene-2,1'-cyclobutane]-6-yl]butanoic acid (PubChem CID 67197966) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is 3,3-dimethyl-2-[(1S,5R,6S)-6-(nitromethyl)spiro[bicyclo[3.2.0]hept-3-ene-2,1'-cyclobutane]-6-yl]butanoic acid.
| Compound Name | 3,3-dimethyl-2-[(1S,5R,6S)-6-(nitromethyl)spiro[bicyclo[3.2.0]hept-3-ene-2,1'-cyclobutane]-6-yl]butanoic acid |
|---|---|
| PubChem CID | 67197966 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 3,3-dimethyl-2-[(1S,5R,6S)-6-(nitromethyl)spiro[bicyclo[3.2.0]hept-3-ene-2,1'-cyclobutane]-6-yl]butanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)[C@]1(C[N+](=O)[O-])C[C@H]2[C@H]1C=CC21CCC1 |
| InChI | InChI=1S/C17H25NO4/c1-15(2,3)13(14(19)20)17(10-18(21)22)9-12-11(17)5-8-16(12)6-4-7-16/h5,8,11-13H,4,6-7,9-10H2,1-3H3,(H,19,20)/t11-,12+,13?,17+/m1/s1 |
| InChIKey | NZAXQKKCNUTRHB-IQTUSZRKSA-N |
| XLogP | 3.37 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|