C24H27FN4O3S — CID 67198630
N-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]methyl]-N,3,5-trimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 67198630) has the molecular formula C24H27FN4O3S and a molecular weight of 470.57 g/mol. Its IUPAC name is N-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]methyl]-N,3,5-trimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]methyl]-N,3,5-trimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 67198630 |
| Molecular Formula | C24H27FN4O3S |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | N-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]methyl]-N,3,5-trimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)N(C)C[C@H]1CCC2=C1[C@@H](C)c1cnn(-c3ccc(F)cc3)c1C2 |
| InChI | InChI=1S/C24H27FN4O3S/c1-14-21-12-26-29(20-9-7-19(25)8-10-20)22(21)11-17-5-6-18(23(14)17)13-28(4)33(30,31)24-15(2)27-32-16(24)3/h7-10,12,14,18H,5-6,11,13H2,1-4H3/t14-,18+/m0/s1 |
| InChIKey | PRHXXDSTOXJQTK-KBXCAEBGSA-N |
| XLogP | 4.30 |
| TPSA | 81.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|