C29H37N5 — CID 67198974
trans-(1S,2S)-2-N-[[4-[(pyridin-2-ylmethylamino)methyl]phenyl]methyl]-2-N-(5,6,7,8-tetrahydroquinolin-8-yl)cyclohexane-1,2-diamine (PubChem CID 67198974) has the molecular formula C29H37N5 and a molecular weight of 455.65 g/mol. Its IUPAC name is trans-(1S,2S)-2-N-[[4-[(pyridin-2-ylmethylamino)methyl]phenyl]methyl]-2-N-(5,6,7,8-tetrahydroquinolin-8-yl)cyclohexane-1,2-diamine.
| Compound Name | trans-(1S,2S)-2-N-[[4-[(pyridin-2-ylmethylamino)methyl]phenyl]methyl]-2-N-(5,6,7,8-tetrahydroquinolin-8-yl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 67198974 |
| Molecular Formula | C29H37N5 |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.30 |
| IUPAC Name | trans-(1S,2S)-2-N-[[4-[(pyridin-2-ylmethylamino)methyl]phenyl]methyl]-2-N-(5,6,7,8-tetrahydroquinolin-8-yl)cyclohexane-1,2-diamine |
| SMILES | N[C@H]1CCCC[C@@H]1N(Cc1ccc(CNCc2ccccn2)cc1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C29H37N5/c30-26-10-1-2-11-27(26)34(28-12-5-7-24-8-6-18-33-29(24)28)21-23-15-13-22(14-16-23)19-31-20-25-9-3-4-17-32-25/h3-4,6,8-9,13-18,26-28,31H,1-2,5,7,10-12,19-21,30H2/t26-,27-,28?/m0/s1 |
| InChIKey | DEPCBODWMCNAKO-ZLBDCPSSSA-N |
| XLogP | 4.92 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |