C19H31NO2 — CID 67199066
2-[(1S,5R,6R)-6-(aminomethyl)-3-cyclopentyl-6-bicyclo[3.2.0]hept-3-enyl]-3,3-dimethylbutanoic acid (PubChem CID 67199066) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is 2-[(1S,5R,6R)-6-(aminomethyl)-3-cyclopentyl-6-bicyclo[3.2.0]hept-3-enyl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[(1S,5R,6R)-6-(aminomethyl)-3-cyclopentyl-6-bicyclo[3.2.0]hept-3-enyl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 67199066 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | 2-[(1S,5R,6R)-6-(aminomethyl)-3-cyclopentyl-6-bicyclo[3.2.0]hept-3-enyl]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)[C@@]1(CN)C[C@@H]2CC(C3CCCC3)=C[C@@H]21 |
| InChI | InChI=1S/C19H31NO2/c1-18(2,3)16(17(21)22)19(11-20)10-14-8-13(9-15(14)19)12-6-4-5-7-12/h9,12,14-16H,4-8,10-11,20H2,1-3H3,(H,21,22)/t14-,15-,16?,19+/m0/s1 |
| InChIKey | RWULGUTXPPPQEC-CJEYDRFVSA-N |
| XLogP | 3.83 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|