About 2-methylpropan-2-amine;(E)-3-(2-phenylphenyl)prop-2-enoic acid
2-methylpropan-2-amine;(E)-3-(2-phenylphenyl)prop-2-enoic acid (PubChem CID 67199122) has the molecular formula C19H23NO2
and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-methylpropan-2-amine;(E)-3-(2-phenylphenyl)prop-2-enoic acid.
Molecular Properties
| Compound Name | 2-methylpropan-2-amine;(E)-3-(2-phenylphenyl)prop-2-enoic acid |
| PubChem CID | 67199122 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 2-methylpropan-2-amine;(E)-3-(2-phenylphenyl)prop-2-enoic acid |
| SMILES | CC(C)(C)N.O=C(O)/C=C/c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C15H12O2.C4H11N/c16-15(17)11-10-13-8-4-5-9-14(13)12-6-2-1-3-7-12;1-4(2,3)5/h1-11H,(H,16,17);5H2,1-3H3/b11-10+; |
| InChIKey | MLLVVVVFGNCVOG-ASTDGNLGSA-N |
| XLogP | 4.20 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropan-2-amine;(E)-3-(2-phenylphenyl)prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropan-2-amine;(E)-3-(2-phenylphenyl)prop-2-enoic acid?
The IUPAC name of 2-methylpropan-2-amine;(E)-3-(2-phenylphenyl)prop-2-enoic acid (CID 67199122) is 2-methylpropan-2-amine;(E)-3-(2-phenylphenyl)prop-2-enoic acid.
What is the SMILES notation for 2-methylpropan-2-amine;(E)-3-(2-phenylphenyl)prop-2-enoic acid?
The canonical SMILES for 2-methylpropan-2-amine;(E)-3-(2-phenylphenyl)prop-2-enoic acid is CC(C)(C)N.O=C(O)/C=C/c1ccccc1-c1ccccc1.
What is the InChIKey of 2-methylpropan-2-amine;(E)-3-(2-phenylphenyl)prop-2-enoic acid?
The InChIKey is MLLVVVVFGNCVOG-ASTDGNLGSA-N. The full InChI is InChI=1S/C15H12O2.C4H11N/c16-15(17)11-10-13-8-4-5-9-14(13)12-6-2-1-3-7-12;1-4(2,3)5/h1-11H,(H,16,17);5H2,1-3H3/b11-10+;.
What are the key properties of 2-methylpropan-2-amine;(E)-3-(2-phenylphenyl)prop-2-enoic acid?
2-methylpropan-2-amine;(E)-3-(2-phenylphenyl)prop-2-enoic acid has a molecular weight of 297.40 g/mol, XLogP of 4.20, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropan-2-amine;(E)-3-(2-phenylphenyl)prop-2-enoic acid is sourced from PubChem (CID 67199122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).