About 1-pentylpyrazolidine-3,5-dione
1-pentylpyrazolidine-3,5-dione (PubChem CID 67200198) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is 1-pentylpyrazolidine-3,5-dione.
Molecular Properties
| Compound Name | 1-pentylpyrazolidine-3,5-dione |
| PubChem CID | 67200198 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 1-pentylpyrazolidine-3,5-dione |
| SMILES | CCCCCN1NC(=O)CC1=O |
| InChI | InChI=1S/C8H14N2O2/c1-2-3-4-5-10-8(12)6-7(11)9-10/h2-6H2,1H3,(H,9,11) |
| InChIKey | DYSXZVHTUUDUIY-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-pentylpyrazolidine-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentylpyrazolidine-3,5-dione?
The IUPAC name of 1-pentylpyrazolidine-3,5-dione (CID 67200198) is 1-pentylpyrazolidine-3,5-dione.
What is the SMILES notation for 1-pentylpyrazolidine-3,5-dione?
The canonical SMILES for 1-pentylpyrazolidine-3,5-dione is CCCCCN1NC(=O)CC1=O.
What is the InChIKey of 1-pentylpyrazolidine-3,5-dione?
The InChIKey is DYSXZVHTUUDUIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2/c1-2-3-4-5-10-8(12)6-7(11)9-10/h2-6H2,1H3,(H,9,11).
What are the key properties of 1-pentylpyrazolidine-3,5-dione?
1-pentylpyrazolidine-3,5-dione has a molecular weight of 170.21 g/mol, XLogP of 0.44, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentylpyrazolidine-3,5-dione is sourced from PubChem (CID 67200198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).