C26H50N4O6 — CID 67200360
2-[4,7-bis(1-carboxy-2,2-dimethylpropyl)-1,4,7,10-tetrazacyclododec-1-yl]-3,3-dimethylbutanoic acid (PubChem CID 67200360) has the molecular formula C26H50N4O6 and a molecular weight of 514.71 g/mol. Its IUPAC name is 2-[4,7-bis(1-carboxy-2,2-dimethylpropyl)-1,4,7,10-tetrazacyclododec-1-yl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[4,7-bis(1-carboxy-2,2-dimethylpropyl)-1,4,7,10-tetrazacyclododec-1-yl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 67200360 |
| Molecular Formula | C26H50N4O6 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.37 |
| IUPAC Name | 2-[4,7-bis(1-carboxy-2,2-dimethylpropyl)-1,4,7,10-tetrazacyclododec-1-yl]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)N1CCNCCN(C(C(=O)O)C(C)(C)C)CCN(C(C(=O)O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C26H50N4O6/c1-24(2,3)18(21(31)32)28-12-10-27-11-13-29(19(22(33)34)25(4,5)6)15-17-30(16-14-28)20(23(35)36)26(7,8)9/h18-20,27H,10-17H2,1-9H3,(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | JFPNVRBXZDJBIR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 133.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |