About 1-chlorocyclohexa-3,5-diene-1,3-diamine
1-chlorocyclohexa-3,5-diene-1,3-diamine (PubChem CID 67200472) has the molecular formula C6H9ClN2
and a molecular weight of 144.61 g/mol. Its IUPAC name is 1-chlorocyclohexa-3,5-diene-1,3-diamine.
Molecular Properties
| Compound Name | 1-chlorocyclohexa-3,5-diene-1,3-diamine |
| PubChem CID | 67200472 |
| Molecular Formula | C6H9ClN2 |
| Molecular Weight | 144.61 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | 1-chlorocyclohexa-3,5-diene-1,3-diamine |
| SMILES | NC1=CC=CC(N)(Cl)C1 |
| InChI | InChI=1S/C6H9ClN2/c7-6(9)3-1-2-5(8)4-6/h1-3H,4,8-9H2 |
| InChIKey | ZVUWTCKDIHCWAI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.61 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-chlorocyclohexa-3,5-diene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chlorocyclohexa-3,5-diene-1,3-diamine?
The IUPAC name of 1-chlorocyclohexa-3,5-diene-1,3-diamine (CID 67200472) is 1-chlorocyclohexa-3,5-diene-1,3-diamine.
What is the SMILES notation for 1-chlorocyclohexa-3,5-diene-1,3-diamine?
The canonical SMILES for 1-chlorocyclohexa-3,5-diene-1,3-diamine is NC1=CC=CC(N)(Cl)C1.
What is the InChIKey of 1-chlorocyclohexa-3,5-diene-1,3-diamine?
The InChIKey is ZVUWTCKDIHCWAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClN2/c7-6(9)3-1-2-5(8)4-6/h1-3H,4,8-9H2.
What are the key properties of 1-chlorocyclohexa-3,5-diene-1,3-diamine?
1-chlorocyclohexa-3,5-diene-1,3-diamine has a molecular weight of 144.61 g/mol, XLogP of 0.68, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chlorocyclohexa-3,5-diene-1,3-diamine is sourced from PubChem (CID 67200472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).