C9H10FNO — CID 67200593
8-fluoro-2,3,4,5-tetrahydro-1,4-benzoxazepine (PubChem CID 67200593) has the molecular formula C9H10FNO and a molecular weight of 167.18 g/mol. Its IUPAC name is 8-fluoro-2,3,4,5-tetrahydro-1,4-benzoxazepine.
| Compound Name | 8-fluoro-2,3,4,5-tetrahydro-1,4-benzoxazepine |
|---|---|
| PubChem CID | 67200593 |
| Molecular Formula | C9H10FNO |
| Molecular Weight | 167.18 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 8-fluoro-2,3,4,5-tetrahydro-1,4-benzoxazepine |
| SMILES | Fc1ccc2c(c1)OCCNC2 |
| InChI | InChI=1S/C9H10FNO/c10-8-2-1-7-6-11-3-4-12-9(7)5-8/h1-2,5,11H,3-4,6H2 |
| InChIKey | MCVXZLUQBPRIOC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.18 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |