C27H24F3NO5 — CID 67201018
1-[bis(4-methoxyphenyl)methyl]-6-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylic acid (PubChem CID 67201018) has the molecular formula C27H24F3NO5 and a molecular weight of 499.49 g/mol. Its IUPAC name is 1-[bis(4-methoxyphenyl)methyl]-6-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylic acid.
| Compound Name | 1-[bis(4-methoxyphenyl)methyl]-6-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 67201018 |
| Molecular Formula | C27H24F3NO5 |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 1-[bis(4-methoxyphenyl)methyl]-6-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylic acid |
| SMILES | COc1ccc(C(c2ccc(OC)cc2)N2CC(C(=O)O)C(c3cc(F)c(F)cc3F)CC2=O)cc1 |
| InChI | InChI=1S/C27H24F3NO5/c1-35-17-7-3-15(4-8-17)26(16-5-9-18(36-2)10-6-16)31-14-21(27(33)34)19(12-25(31)32)20-11-23(29)24(30)13-22(20)28/h3-11,13,19,21,26H,12,14H2,1-2H3,(H,33,34) |
| InChIKey | ORIQROFMPNHISL-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|