C19H29NO4 — CID 67201548
2-[(1R,5R,6S)-3-cyclopentyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]-3,3-dimethylbutanoic acid (PubChem CID 67201548) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is 2-[(1R,5R,6S)-3-cyclopentyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[(1R,5R,6S)-3-cyclopentyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 67201548 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 2-[(1R,5R,6S)-3-cyclopentyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)[C@]1(C[N+](=O)[O-])C[C@H]2CC(C3CCCC3)=C[C@@H]21 |
| InChI | InChI=1S/C19H29NO4/c1-18(2,3)16(17(21)22)19(11-20(23)24)10-14-8-13(9-15(14)19)12-6-4-5-7-12/h9,12,14-16H,4-8,10-11H2,1-3H3,(H,21,22)/t14-,15+,16?,19+/m1/s1 |
| InChIKey | WTRNEDIBHIFZGB-CTZHQLGESA-N |
| XLogP | 4.15 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|