C28H29N5O4S — CID 67201862
tert-butyl 4-[[8-(benzenesulfonyl)-4-cyano-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-3-yl]methyl]piperidine-1-carboxylate (PubChem CID 67201862) has the molecular formula C28H29N5O4S and a molecular weight of 531.64 g/mol. Its IUPAC name is tert-butyl 4-[[8-(benzenesulfonyl)-4-cyano-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-3-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[8-(benzenesulfonyl)-4-cyano-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-3-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67201862 |
| Molecular Formula | C28H29N5O4S |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | tert-butyl 4-[[8-(benzenesulfonyl)-4-cyano-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-3-yl]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Cc2c(C#N)ncc3c2c2cccnc2n3S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H29N5O4S/c1-28(2,3)37-27(34)32-14-11-19(12-15-32)16-22-23(17-29)31-18-24-25(22)21-10-7-13-30-26(21)33(24)38(35,36)20-8-5-4-6-9-20/h4-10,13,18-19H,11-12,14-16H2,1-3H3 |
| InChIKey | SQJSDOYUUDJUDT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 118.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |