C22H27FN2O3 — CID 67202334
ethylcarbamic acid;7-[(2-fluorophenyl)methoxy]-4-methyl-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole (PubChem CID 67202334) has the molecular formula C22H27FN2O3 and a molecular weight of 386.47 g/mol. Its IUPAC name is ethylcarbamic acid;7-[(2-fluorophenyl)methoxy]-4-methyl-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole.
| Compound Name | ethylcarbamic acid;7-[(2-fluorophenyl)methoxy]-4-methyl-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole |
|---|---|
| PubChem CID | 67202334 |
| Molecular Formula | C22H27FN2O3 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | ethylcarbamic acid;7-[(2-fluorophenyl)methoxy]-4-methyl-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole |
| SMILES | CC1c2ccc(OCc3ccccc3F)cc2C2CNCC12.CCNC(=O)O |
| InChI | InChI=1S/C19H20FNO.C3H7NO2/c1-12-15-7-6-14(8-16(15)18-10-21-9-17(12)18)22-11-13-4-2-3-5-19(13)20;1-2-4-3(5)6/h2-8,12,17-18,21H,9-11H2,1H3;4H,2H2,1H3,(H,5,6) |
| InChIKey | IBVBMIDVXGLPBY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |