C17H23N3O3 — CID 67202489
ethylcarbamic acid;7-methoxy-4-methyl-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole-6-carbonitrile (PubChem CID 67202489) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is ethylcarbamic acid;7-methoxy-4-methyl-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole-6-carbonitrile.
| Compound Name | ethylcarbamic acid;7-methoxy-4-methyl-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole-6-carbonitrile |
|---|---|
| PubChem CID | 67202489 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | ethylcarbamic acid;7-methoxy-4-methyl-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole-6-carbonitrile |
| SMILES | CCNC(=O)O.COc1cc2c(cc1C#N)C(C)C1CNCC21 |
| InChI | InChI=1S/C14H16N2O.C3H7NO2/c1-8-10-3-9(5-15)14(17-2)4-11(10)13-7-16-6-12(8)13;1-2-4-3(5)6/h3-4,8,12-13,16H,6-7H2,1-2H3;4H,2H2,1H3,(H,5,6) |
| InChIKey | QNLQHVHPUXTOQO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |