C35H45ClN6O4Si — CID 67203446
1-[2-chloro-4-[6-[4-(2-pyrrolidin-1-ylpropoxy)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]oxyphenyl]-3-cyclopropylurea (PubChem CID 67203446) has the molecular formula C35H45ClN6O4Si and a molecular weight of 677.32 g/mol. Its IUPAC name is 1-[2-chloro-4-[6-[4-(2-pyrrolidin-1-ylpropoxy)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]oxyphenyl]-3-cyclopropylurea.
| Compound Name | 1-[2-chloro-4-[6-[4-(2-pyrrolidin-1-ylpropoxy)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]oxyphenyl]-3-cyclopropylurea |
|---|---|
| PubChem CID | 67203446 |
| Molecular Formula | C35H45ClN6O4Si |
| Molecular Weight | 677.32 g/mol |
| Exact Mass | 676.30 |
| IUPAC Name | 1-[2-chloro-4-[6-[4-(2-pyrrolidin-1-ylpropoxy)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]oxyphenyl]-3-cyclopropylurea |
| SMILES | CC(COc1ccc(-c2cc3c(Oc4ccc(NC(=O)NC5CC5)c(Cl)c4)ncnc3n2COCC[Si](C)(C)C)cc1)N1CCCC1 |
| InChI | InChI=1S/C35H45ClN6O4Si/c1-24(41-15-5-6-16-41)21-45-27-11-7-25(8-12-27)32-20-29-33(42(32)23-44-17-18-47(2,3)4)37-22-38-34(29)46-28-13-14-31(30(36)19-28)40-35(43)39-26-9-10-26/h7-8,11-14,19-20,22,24,26H,5-6,9-10,15-18,21,23H2,1-4H3,(H2,39,40,43) |
| InChIKey | WVZVFINKWTXFCO-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.32 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|