About 1-(2-methylbutan-2-yloxy)ethyl 2-ethenylbenzoate
1-(2-methylbutan-2-yloxy)ethyl 2-ethenylbenzoate (PubChem CID 67203893) has the molecular formula C16H22O3
and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-(2-methylbutan-2-yloxy)ethyl 2-ethenylbenzoate.
Molecular Properties
| Compound Name | 1-(2-methylbutan-2-yloxy)ethyl 2-ethenylbenzoate |
| PubChem CID | 67203893 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 1-(2-methylbutan-2-yloxy)ethyl 2-ethenylbenzoate |
| SMILES | C=Cc1ccccc1C(=O)OC(C)OC(C)(C)CC |
| InChI | InChI=1S/C16H22O3/c1-6-13-10-8-9-11-14(13)15(17)18-12(3)19-16(4,5)7-2/h6,8-12H,1,7H2,2-5H3 |
| InChIKey | BDILEGPHDHTIGH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methylbutan-2-yloxy)ethyl 2-ethenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylbutan-2-yloxy)ethyl 2-ethenylbenzoate?
The IUPAC name of 1-(2-methylbutan-2-yloxy)ethyl 2-ethenylbenzoate (CID 67203893) is 1-(2-methylbutan-2-yloxy)ethyl 2-ethenylbenzoate.
What is the SMILES notation for 1-(2-methylbutan-2-yloxy)ethyl 2-ethenylbenzoate?
The canonical SMILES for 1-(2-methylbutan-2-yloxy)ethyl 2-ethenylbenzoate is C=Cc1ccccc1C(=O)OC(C)OC(C)(C)CC.
What is the InChIKey of 1-(2-methylbutan-2-yloxy)ethyl 2-ethenylbenzoate?
The InChIKey is BDILEGPHDHTIGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O3/c1-6-13-10-8-9-11-14(13)15(17)18-12(3)19-16(4,5)7-2/h6,8-12H,1,7H2,2-5H3.
What are the key properties of 1-(2-methylbutan-2-yloxy)ethyl 2-ethenylbenzoate?
1-(2-methylbutan-2-yloxy)ethyl 2-ethenylbenzoate has a molecular weight of 262.35 g/mol, XLogP of 4.04, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylbutan-2-yloxy)ethyl 2-ethenylbenzoate is sourced from PubChem (CID 67203893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).