About 2-chloroethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate
2-chloroethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate (PubChem CID 67204102) has the molecular formula C9H8ClN3O2
and a molecular weight of 225.63 g/mol. Its IUPAC name is 2-chloroethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate.
Molecular Properties
| Compound Name | 2-chloroethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate |
| PubChem CID | 67204102 |
| Molecular Formula | C9H8ClN3O2 |
| Molecular Weight | 225.63 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | 2-chloroethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate |
| SMILES | O=C(OCCCl)c1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C9H8ClN3O2/c10-2-4-15-9(14)7-6-1-3-11-8(6)13-5-12-7/h1,3,5H,2,4H2,(H,11,12,13) |
| InChIKey | YELHQLWNNHZBHZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.63 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate?
The IUPAC name of 2-chloroethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate (CID 67204102) is 2-chloroethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate.
What is the SMILES notation for 2-chloroethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate?
The canonical SMILES for 2-chloroethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate is O=C(OCCCl)c1ncnc2[nH]ccc12.
What is the InChIKey of 2-chloroethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate?
The InChIKey is YELHQLWNNHZBHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClN3O2/c10-2-4-15-9(14)7-6-1-3-11-8(6)13-5-12-7/h1,3,5H,2,4H2,(H,11,12,13).
What are the key properties of 2-chloroethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate?
2-chloroethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate has a molecular weight of 225.63 g/mol, XLogP of 1.35, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate is sourced from PubChem (CID 67204102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).