About bis[2,4-bis(2-tert-butylphenyl)-3-phenylphenoxy]phosphane
bis[2,4-bis(2-tert-butylphenyl)-3-phenylphenoxy]phosphane (PubChem CID 67204106) has the molecular formula C64H67O2P
and a molecular weight of 899.21 g/mol. Its IUPAC name is bis[2,4-bis(2-tert-butylphenyl)-3-phenylphenoxy]phosphane.
Molecular Properties
| Compound Name | bis[2,4-bis(2-tert-butylphenyl)-3-phenylphenoxy]phosphane |
| PubChem CID | 67204106 |
| Molecular Formula | C64H67O2P |
| Molecular Weight | 899.21 g/mol |
| Exact Mass | 898.49 |
| IUPAC Name | bis[2,4-bis(2-tert-butylphenyl)-3-phenylphenoxy]phosphane |
| SMILES | CC(C)(C)c1ccccc1-c1ccc(OPOc2ccc(-c3ccccc3C(C)(C)C)c(-c3ccccc3)c2-c2ccccc2C(C)(C)C)c(-c2ccccc2C(C)(C)C)c1-c1ccccc1 |
| InChI | InChI=1S/C64H67O2P/c1-61(2,3)51-35-23-19-31-45(51)47-39-41-55(59(57(47)43-27-15-13-16-28-43)49-33-21-25-37-53(49)63(7,8)9)65-67-66-56-42-40-48(46-32-20-24-36-52(46)62(4,5)6)58(44-29-17-14-18-30-44)60(56)50-34-22-26-38-54(50)64(10,11)12/h13-42,67H,1-12H3 |
| InChIKey | ZUMWWZSLZAKGFN-UHFFFAOYSA-N |
| XLogP | 18.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 67 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 899.21 |
| LogP ≤ 5 | 18.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis[2,4-bis(2-tert-butylphenyl)-3-phenylphenoxy]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2,4-bis(2-tert-butylphenyl)-3-phenylphenoxy]phosphane?
The IUPAC name of bis[2,4-bis(2-tert-butylphenyl)-3-phenylphenoxy]phosphane (CID 67204106) is bis[2,4-bis(2-tert-butylphenyl)-3-phenylphenoxy]phosphane.
What is the SMILES notation for bis[2,4-bis(2-tert-butylphenyl)-3-phenylphenoxy]phosphane?
The canonical SMILES for bis[2,4-bis(2-tert-butylphenyl)-3-phenylphenoxy]phosphane is CC(C)(C)c1ccccc1-c1ccc(OPOc2ccc(-c3ccccc3C(C)(C)C)c(-c3ccccc3)c2-c2ccccc2C(C)(C)C)c(-c2ccccc2C(C)(C)C)c1-c1ccccc1.
What is the InChIKey of bis[2,4-bis(2-tert-butylphenyl)-3-phenylphenoxy]phosphane?
The InChIKey is ZUMWWZSLZAKGFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C64H67O2P/c1-61(2,3)51-35-23-19-31-45(51)47-39-41-55(59(57(47)43-27-15-13-16-28-43)49-33-21-25-37-53(49)63(7,8)9)65-67-66-56-42-40-48(46-32-20-24-36-52(46)62(4,5)6)58(44-29-17-14-18-30-44)60(56)50-34-22-26-38-54(50)64(10,11)12/h13-42,67H,1-12H3.
What are the key properties of bis[2,4-bis(2-tert-butylphenyl)-3-phenylphenoxy]phosphane?
bis[2,4-bis(2-tert-butylphenyl)-3-phenylphenoxy]phosphane has a molecular weight of 899.21 g/mol, XLogP of 18.84, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2,4-bis(2-tert-butylphenyl)-3-phenylphenoxy]phosphane is sourced from PubChem (CID 67204106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).