C24H40O3 — CID 67204136
[4-oxo-4-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-2-yl] undec-10-enoate (PubChem CID 67204136) has the molecular formula C24H40O3 and a molecular weight of 376.58 g/mol. Its IUPAC name is [4-oxo-4-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-2-yl] undec-10-enoate.
| Compound Name | [4-oxo-4-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-2-yl] undec-10-enoate |
|---|---|
| PubChem CID | 67204136 |
| Molecular Formula | C24H40O3 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | [4-oxo-4-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-2-yl] undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)OC(C)CC(=O)C1C(C)C=CCC1(C)C |
| InChI | InChI=1S/C24H40O3/c1-6-7-8-9-10-11-12-13-16-22(26)27-20(3)18-21(25)23-19(2)15-14-17-24(23,4)5/h6,14-15,19-20,23H,1,7-13,16-18H2,2-5H3 |
| InChIKey | QFPIAZPQYJSEJZ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|