About 1,2-diphenylpyrrole-3,4-diamine
1,2-diphenylpyrrole-3,4-diamine (PubChem CID 67204973) has the molecular formula C16H15N3
and a molecular weight of 249.32 g/mol. Its IUPAC name is 1,2-diphenylpyrrole-3,4-diamine.
Molecular Properties
| Compound Name | 1,2-diphenylpyrrole-3,4-diamine |
| PubChem CID | 67204973 |
| Molecular Formula | C16H15N3 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 1,2-diphenylpyrrole-3,4-diamine |
| SMILES | Nc1cn(-c2ccccc2)c(-c2ccccc2)c1N |
| InChI | InChI=1S/C16H15N3/c17-14-11-19(13-9-5-2-6-10-13)16(15(14)18)12-7-3-1-4-8-12/h1-11H,17-18H2 |
| InChIKey | RYDZMSHNHGGORO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 56.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2-diphenylpyrrole-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diphenylpyrrole-3,4-diamine?
The IUPAC name of 1,2-diphenylpyrrole-3,4-diamine (CID 67204973) is 1,2-diphenylpyrrole-3,4-diamine.
What is the SMILES notation for 1,2-diphenylpyrrole-3,4-diamine?
The canonical SMILES for 1,2-diphenylpyrrole-3,4-diamine is Nc1cn(-c2ccccc2)c(-c2ccccc2)c1N.
What is the InChIKey of 1,2-diphenylpyrrole-3,4-diamine?
The InChIKey is RYDZMSHNHGGORO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3/c17-14-11-19(13-9-5-2-6-10-13)16(15(14)18)12-7-3-1-4-8-12/h1-11H,17-18H2.
What are the key properties of 1,2-diphenylpyrrole-3,4-diamine?
1,2-diphenylpyrrole-3,4-diamine has a molecular weight of 249.32 g/mol, XLogP of 3.31, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diphenylpyrrole-3,4-diamine is sourced from PubChem (CID 67204973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).