C20H18N4O4 — CID 67205209
(Z)-2-cyano-3-[3-(3,4,5-trimethoxyphenyl)-1H-indazol-5-yl]prop-2-enamide (PubChem CID 67205209) has the molecular formula C20H18N4O4 and a molecular weight of 378.39 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3-(3,4,5-trimethoxyphenyl)-1H-indazol-5-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3-(3,4,5-trimethoxyphenyl)-1H-indazol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 67205209 |
| Molecular Formula | C20H18N4O4 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | (Z)-2-cyano-3-[3-(3,4,5-trimethoxyphenyl)-1H-indazol-5-yl]prop-2-enamide |
| SMILES | COc1cc(-c2n[nH]c3ccc(/C=C(/C#N)C(N)=O)cc23)cc(OC)c1OC |
| InChI | InChI=1S/C20H18N4O4/c1-26-16-8-12(9-17(27-2)19(16)28-3)18-14-7-11(4-5-15(14)23-24-18)6-13(10-21)20(22)25/h4-9H,1-3H3,(H2,22,25)(H,23,24)/b13-6- |
| InChIKey | IBUMAHMUIWPTCV-MLPAPPSSSA-N |
| XLogP | 2.65 |
| TPSA | 123.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|