C20H28O3 — CID 67205290
(3R,8R,9S,10R,13S,14S)-3-methoxy-10,13-dimethyl-2,3,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-6,17-dione (PubChem CID 67205290) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (3R,8R,9S,10R,13S,14S)-3-methoxy-10,13-dimethyl-2,3,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-6,17-dione.
| Compound Name | (3R,8R,9S,10R,13S,14S)-3-methoxy-10,13-dimethyl-2,3,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-6,17-dione |
|---|---|
| PubChem CID | 67205290 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (3R,8R,9S,10R,13S,14S)-3-methoxy-10,13-dimethyl-2,3,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-6,17-dione |
| SMILES | CO[C@H]1C=C2C(=O)C[C@@H]3[C@H](CC[C@]4(C)C(=O)CC[C@@H]34)[C@@]2(C)CC1 |
| InChI | InChI=1S/C20H28O3/c1-19-8-6-12(23-3)10-16(19)17(21)11-13-14-4-5-18(22)20(14,2)9-7-15(13)19/h10,12-15H,4-9,11H2,1-3H3/t12-,13+,14+,15+,19-,20+/m1/s1 |
| InChIKey | YMUKHCWRZBKVLF-WAPOVMQPSA-N |
| XLogP | 3.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |