About 2H-pyrazolo[4,3-b]pyridine-1,4-diamine
2H-pyrazolo[4,3-b]pyridine-1,4-diamine (PubChem CID 67205581) has the molecular formula C6H9N5
and a molecular weight of 151.17 g/mol. Its IUPAC name is 2H-pyrazolo[4,3-b]pyridine-1,4-diamine.
Molecular Properties
| Compound Name | 2H-pyrazolo[4,3-b]pyridine-1,4-diamine |
| PubChem CID | 67205581 |
| Molecular Formula | C6H9N5 |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.09 |
| IUPAC Name | 2H-pyrazolo[4,3-b]pyridine-1,4-diamine |
| SMILES | NN1C=CC=C2C1=CNN2N |
| InChI | InChI=1S/C6H9N5/c7-10-3-1-2-5-6(10)4-9-11(5)8/h1-4,9H,7-8H2 |
| InChIKey | GUSRNRVZHPWKCB-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 70.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 2H-pyrazolo[4,3-b]pyridine-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyrazolo[4,3-b]pyridine-1,4-diamine?
The IUPAC name of 2H-pyrazolo[4,3-b]pyridine-1,4-diamine (CID 67205581) is 2H-pyrazolo[4,3-b]pyridine-1,4-diamine.
What is the SMILES notation for 2H-pyrazolo[4,3-b]pyridine-1,4-diamine?
The canonical SMILES for 2H-pyrazolo[4,3-b]pyridine-1,4-diamine is NN1C=CC=C2C1=CNN2N.
What is the InChIKey of 2H-pyrazolo[4,3-b]pyridine-1,4-diamine?
The InChIKey is GUSRNRVZHPWKCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N5/c7-10-3-1-2-5-6(10)4-9-11(5)8/h1-4,9H,7-8H2.
What are the key properties of 2H-pyrazolo[4,3-b]pyridine-1,4-diamine?
2H-pyrazolo[4,3-b]pyridine-1,4-diamine has a molecular weight of 151.17 g/mol, XLogP of -0.89, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyrazolo[4,3-b]pyridine-1,4-diamine is sourced from PubChem (CID 67205581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).