C20H19FN2O2 — CID 67206078
benzyl N-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)carbamate (PubChem CID 67206078) has the molecular formula C20H19FN2O2 and a molecular weight of 338.38 g/mol. Its IUPAC name is benzyl N-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)carbamate.
| Compound Name | benzyl N-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)carbamate |
|---|---|
| PubChem CID | 67206078 |
| Molecular Formula | C20H19FN2O2 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | benzyl N-(6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)carbamate |
| SMILES | O=C(NC1CCc2[nH]c3ccc(F)cc3c2C1)OCc1ccccc1 |
| InChI | InChI=1S/C20H19FN2O2/c21-14-6-8-18-16(10-14)17-11-15(7-9-19(17)23-18)22-20(24)25-12-13-4-2-1-3-5-13/h1-6,8,10,15,23H,7,9,11-12H2,(H,22,24) |
| InChIKey | SSOLTIBLFSTGMY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|