C7H9NO — CID 67206346
2,3,5,6a-tetrahydro-1H-cyclopenta[c]pyrrol-6-one (PubChem CID 67206346) has the molecular formula C7H9NO and a molecular weight of 123.15 g/mol. Its IUPAC name is 2,3,5,6a-tetrahydro-1H-cyclopenta[c]pyrrol-6-one.
| Compound Name | 2,3,5,6a-tetrahydro-1H-cyclopenta[c]pyrrol-6-one |
|---|---|
| PubChem CID | 67206346 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | 2,3,5,6a-tetrahydro-1H-cyclopenta[c]pyrrol-6-one |
| SMILES | O=C1CC=C2CNCC12 |
| InChI | InChI=1S/C7H9NO/c9-7-2-1-5-3-8-4-6(5)7/h1,6,8H,2-4H2 |
| InChIKey | HUIBQHSLVUGYCA-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|