C52H64OSi — CID 67206743
[2,7-bis(3-tert-butylphenyl)-9H-fluoren-9-yl]-(3,5-ditert-butyl-2-prop-2-enoxyphenyl)-dimethylsilane (PubChem CID 67206743) has the molecular formula C52H64OSi and a molecular weight of 733.17 g/mol. Its IUPAC name is [2,7-bis(3-tert-butylphenyl)-9H-fluoren-9-yl]-(3,5-ditert-butyl-2-prop-2-enoxyphenyl)-dimethylsilane.
| Compound Name | [2,7-bis(3-tert-butylphenyl)-9H-fluoren-9-yl]-(3,5-ditert-butyl-2-prop-2-enoxyphenyl)-dimethylsilane |
|---|---|
| PubChem CID | 67206743 |
| Molecular Formula | C52H64OSi |
| Molecular Weight | 733.17 g/mol |
| Exact Mass | 732.47 |
| IUPAC Name | [2,7-bis(3-tert-butylphenyl)-9H-fluoren-9-yl]-(3,5-ditert-butyl-2-prop-2-enoxyphenyl)-dimethylsilane |
| SMILES | C=CCOc1c(C(C)(C)C)cc(C(C)(C)C)cc1[Si](C)(C)C1c2cc(-c3cccc(C(C)(C)C)c3)ccc2-c2ccc(-c3cccc(C(C)(C)C)c3)cc21 |
| InChI | InChI=1S/C52H64OSi/c1-16-27-53-47-45(52(11,12)13)32-40(51(8,9)10)33-46(47)54(14,15)48-43-30-36(34-19-17-21-38(28-34)49(2,3)4)23-25-41(43)42-26-24-37(31-44(42)48)35-20-18-22-39(29-35)50(5,6)7/h16-26,28-33,48H,1,27H2,2-15H3 |
| InChIKey | IYPGZNFXFRRQIV-UHFFFAOYSA-N |
| XLogP | 14.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.17 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|