About 4-[2,5-dibromo-3-(3-fluorophenyl)imidazol-4-yl]-3,5-difluorobenzonitrile
4-[2,5-dibromo-3-(3-fluorophenyl)imidazol-4-yl]-3,5-difluorobenzonitrile (PubChem CID 67207270) has the molecular formula C16H6Br2F3N3
and a molecular weight of 457.05 g/mol. Its IUPAC name is 4-[2,5-dibromo-3-(3-fluorophenyl)imidazol-4-yl]-3,5-difluorobenzonitrile.
Molecular Properties
| Compound Name | 4-[2,5-dibromo-3-(3-fluorophenyl)imidazol-4-yl]-3,5-difluorobenzonitrile |
| PubChem CID | 67207270 |
| Molecular Formula | C16H6Br2F3N3 |
| Molecular Weight | 457.05 g/mol |
| Exact Mass | 454.89 |
| IUPAC Name | 4-[2,5-dibromo-3-(3-fluorophenyl)imidazol-4-yl]-3,5-difluorobenzonitrile |
| SMILES | N#Cc1cc(F)c(-c2c(Br)nc(Br)n2-c2cccc(F)c2)c(F)c1 |
| InChI | InChI=1S/C16H6Br2F3N3/c17-15-14(13-11(20)4-8(7-22)5-12(13)21)24(16(18)23-15)10-3-1-2-9(19)6-10/h1-6H |
| InChIKey | XGQUYDIFSSUIPV-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.05 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2,5-dibromo-3-(3-fluorophenyl)imidazol-4-yl]-3,5-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,5-dibromo-3-(3-fluorophenyl)imidazol-4-yl]-3,5-difluorobenzonitrile?
The IUPAC name of 4-[2,5-dibromo-3-(3-fluorophenyl)imidazol-4-yl]-3,5-difluorobenzonitrile (CID 67207270) is 4-[2,5-dibromo-3-(3-fluorophenyl)imidazol-4-yl]-3,5-difluorobenzonitrile.
What is the SMILES notation for 4-[2,5-dibromo-3-(3-fluorophenyl)imidazol-4-yl]-3,5-difluorobenzonitrile?
The canonical SMILES for 4-[2,5-dibromo-3-(3-fluorophenyl)imidazol-4-yl]-3,5-difluorobenzonitrile is N#Cc1cc(F)c(-c2c(Br)nc(Br)n2-c2cccc(F)c2)c(F)c1.
What is the InChIKey of 4-[2,5-dibromo-3-(3-fluorophenyl)imidazol-4-yl]-3,5-difluorobenzonitrile?
The InChIKey is XGQUYDIFSSUIPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H6Br2F3N3/c17-15-14(13-11(20)4-8(7-22)5-12(13)21)24(16(18)23-15)10-3-1-2-9(19)6-10/h1-6H.
What are the key properties of 4-[2,5-dibromo-3-(3-fluorophenyl)imidazol-4-yl]-3,5-difluorobenzonitrile?
4-[2,5-dibromo-3-(3-fluorophenyl)imidazol-4-yl]-3,5-difluorobenzonitrile has a molecular weight of 457.05 g/mol, XLogP of 5.35, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,5-dibromo-3-(3-fluorophenyl)imidazol-4-yl]-3,5-difluorobenzonitrile is sourced from PubChem (CID 67207270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).