C6H6O6 — CID 67207406
cis-(4S,6R)-4,5,6-trihydroxycyclohexane-1,2,3-trione (PubChem CID 67207406) has the molecular formula C6H6O6 and a molecular weight of 174.11 g/mol. Its IUPAC name is cis-(4S,6R)-4,5,6-trihydroxycyclohexane-1,2,3-trione.
| Compound Name | cis-(4S,6R)-4,5,6-trihydroxycyclohexane-1,2,3-trione |
|---|---|
| PubChem CID | 67207406 |
| Molecular Formula | C6H6O6 |
| Molecular Weight | 174.11 g/mol |
| Exact Mass | 174.02 |
| IUPAC Name | cis-(4S,6R)-4,5,6-trihydroxycyclohexane-1,2,3-trione |
| SMILES | O=C1C(=O)[C@@H](O)C(O)[C@@H](O)C1=O |
| InChI | InChI=1S/C6H6O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-3,7-9H/t1?,2-,3+ |
| InChIKey | OCDBCIPWGNDKJQ-MZJVJLTCSA-N |
| XLogP | -3.21 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.11 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|