C23H28N2O4 — CID 67207513
N-[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-11-propyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-10-yl]prop-2-enamide (PubChem CID 67207513) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-11-propyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-10-yl]prop-2-enamide.
| Compound Name | N-[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-11-propyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-10-yl]prop-2-enamide |
|---|---|
| PubChem CID | 67207513 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-11-propyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-10-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1c(O)c2c3c(c1CCC)C[C@@H]1[C@@H]4C=C[C@H](O)[C@H](O2)[C@]34CCN1C |
| InChI | InChI=1S/C23H28N2O4/c1-4-6-12-13-11-15-14-7-8-16(26)22-23(14,9-10-25(15)3)18(13)21(29-22)20(28)19(12)24-17(27)5-2/h5,7-8,14-16,22,26,28H,2,4,6,9-11H2,1,3H3,(H,24,27)/t14-,15+,16-,22-,23-/m0/s1 |
| InChIKey | VTNAKHKXQKTTSK-LNVVDLBQSA-N |
| XLogP | 2.28 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|