C23H18BrClN2O4S — CID 67207536
tert-butyl 2-[(5-bromo-1,3-benzoxazole-2-carbonyl)amino]-4-(4-chlorophenyl)thiophene-3-carboxylate (PubChem CID 67207536) has the molecular formula C23H18BrClN2O4S and a molecular weight of 533.83 g/mol. Its IUPAC name is tert-butyl 2-[(5-bromo-1,3-benzoxazole-2-carbonyl)amino]-4-(4-chlorophenyl)thiophene-3-carboxylate.
| Compound Name | tert-butyl 2-[(5-bromo-1,3-benzoxazole-2-carbonyl)amino]-4-(4-chlorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 67207536 |
| Molecular Formula | C23H18BrClN2O4S |
| Molecular Weight | 533.83 g/mol |
| Exact Mass | 531.99 |
| IUPAC Name | tert-butyl 2-[(5-bromo-1,3-benzoxazole-2-carbonyl)amino]-4-(4-chlorophenyl)thiophene-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1c(-c2ccc(Cl)cc2)csc1NC(=O)c1nc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C23H18BrClN2O4S/c1-23(2,3)31-22(29)18-15(12-4-7-14(25)8-5-12)11-32-21(18)27-19(28)20-26-16-10-13(24)6-9-17(16)30-20/h4-11H,1-3H3,(H,27,28) |
| InChIKey | RSJZSMCQQOOEQX-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.83 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|