C24H19ClN6O — CID 67207625
(E)-3-[3-[4-amino-5-(4-chlorophenyl)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-2-cyano-N,N-dimethylprop-2-enamide (PubChem CID 67207625) has the molecular formula C24H19ClN6O and a molecular weight of 442.91 g/mol. Its IUPAC name is (E)-3-[3-[4-amino-5-(4-chlorophenyl)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-2-cyano-N,N-dimethylprop-2-enamide.
| Compound Name | (E)-3-[3-[4-amino-5-(4-chlorophenyl)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-2-cyano-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 67207625 |
| Molecular Formula | C24H19ClN6O |
| Molecular Weight | 442.91 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | (E)-3-[3-[4-amino-5-(4-chlorophenyl)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-2-cyano-N,N-dimethylprop-2-enamide |
| SMILES | CN(C)C(=O)/C(C#N)=C/c1cccc(-n2cc(-c3ccc(Cl)cc3)c3c(N)ncnc32)c1 |
| InChI | InChI=1S/C24H19ClN6O/c1-30(2)24(32)17(12-26)10-15-4-3-5-19(11-15)31-13-20(16-6-8-18(25)9-7-16)21-22(27)28-14-29-23(21)31/h3-11,13-14H,1-2H3,(H2,27,28,29)/b17-10+ |
| InChIKey | FAVVILDPBCJWGV-LICLKQGHSA-N |
| XLogP | 4.32 |
| TPSA | 100.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.91 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|