About [2,7-bis(3-methylphenyl)-9H-fluoren-9-yl]-dimethyl-(2-prop-2-enoxyphenyl)silane
[2,7-bis(3-methylphenyl)-9H-fluoren-9-yl]-dimethyl-(2-prop-2-enoxyphenyl)silane (PubChem CID 67207710) has the molecular formula C38H36OSi
and a molecular weight of 536.79 g/mol. Its IUPAC name is [2,7-bis(3-methylphenyl)-9H-fluoren-9-yl]-dimethyl-(2-prop-2-enoxyphenyl)silane.
Molecular Properties
| Compound Name | [2,7-bis(3-methylphenyl)-9H-fluoren-9-yl]-dimethyl-(2-prop-2-enoxyphenyl)silane |
| PubChem CID | 67207710 |
| Molecular Formula | C38H36OSi |
| Molecular Weight | 536.79 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | [2,7-bis(3-methylphenyl)-9H-fluoren-9-yl]-dimethyl-(2-prop-2-enoxyphenyl)silane |
| SMILES | C=CCOc1ccccc1[Si](C)(C)C1c2cc(-c3cccc(C)c3)ccc2-c2ccc(-c3cccc(C)c3)cc21 |
| InChI | InChI=1S/C38H36OSi/c1-6-21-39-36-15-7-8-16-37(36)40(4,5)38-34-24-30(28-13-9-11-26(2)22-28)17-19-32(34)33-20-18-31(25-35(33)38)29-14-10-12-27(3)23-29/h6-20,22-25,38H,1,21H2,2-5H3 |
| InChIKey | AEGFCXLZUYOCOE-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 536.79 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2,7-bis(3-methylphenyl)-9H-fluoren-9-yl]-dimethyl-(2-prop-2-enoxyphenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,7-bis(3-methylphenyl)-9H-fluoren-9-yl]-dimethyl-(2-prop-2-enoxyphenyl)silane?
The IUPAC name of [2,7-bis(3-methylphenyl)-9H-fluoren-9-yl]-dimethyl-(2-prop-2-enoxyphenyl)silane (CID 67207710) is [2,7-bis(3-methylphenyl)-9H-fluoren-9-yl]-dimethyl-(2-prop-2-enoxyphenyl)silane.
What is the SMILES notation for [2,7-bis(3-methylphenyl)-9H-fluoren-9-yl]-dimethyl-(2-prop-2-enoxyphenyl)silane?
The canonical SMILES for [2,7-bis(3-methylphenyl)-9H-fluoren-9-yl]-dimethyl-(2-prop-2-enoxyphenyl)silane is C=CCOc1ccccc1[Si](C)(C)C1c2cc(-c3cccc(C)c3)ccc2-c2ccc(-c3cccc(C)c3)cc21.
What is the InChIKey of [2,7-bis(3-methylphenyl)-9H-fluoren-9-yl]-dimethyl-(2-prop-2-enoxyphenyl)silane?
The InChIKey is AEGFCXLZUYOCOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H36OSi/c1-6-21-39-36-15-7-8-16-37(36)40(4,5)38-34-24-30(28-13-9-11-26(2)22-28)17-19-32(34)33-20-18-31(25-35(33)38)29-14-10-12-27(3)23-29/h6-20,22-25,38H,1,21H2,2-5H3.
What are the key properties of [2,7-bis(3-methylphenyl)-9H-fluoren-9-yl]-dimethyl-(2-prop-2-enoxyphenyl)silane?
[2,7-bis(3-methylphenyl)-9H-fluoren-9-yl]-dimethyl-(2-prop-2-enoxyphenyl)silane has a molecular weight of 536.79 g/mol, XLogP of 9.47, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2,7-bis(3-methylphenyl)-9H-fluoren-9-yl]-dimethyl-(2-prop-2-enoxyphenyl)silane is sourced from PubChem (CID 67207710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).