C32H36F3N5O6 — CID 67208180
tert-butyl N-[(2R,3S,4R,6R)-6-[3-[[6-[4-(dimethylcarbamoyl)-2,6-difluorophenyl]-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-3-hydroxy-2,3-dimethyloxan-4-yl]carbamate (PubChem CID 67208180) has the molecular formula C32H36F3N5O6 and a molecular weight of 643.66 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S,4R,6R)-6-[3-[[6-[4-(dimethylcarbamoyl)-2,6-difluorophenyl]-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-3-hydroxy-2,3-dimethyloxan-4-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S,4R,6R)-6-[3-[[6-[4-(dimethylcarbamoyl)-2,6-difluorophenyl]-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-3-hydroxy-2,3-dimethyloxan-4-yl]carbamate |
|---|---|
| PubChem CID | 67208180 |
| Molecular Formula | C32H36F3N5O6 |
| Molecular Weight | 643.66 g/mol |
| Exact Mass | 643.26 |
| IUPAC Name | tert-butyl N-[(2R,3S,4R,6R)-6-[3-[[6-[4-(dimethylcarbamoyl)-2,6-difluorophenyl]-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-3-hydroxy-2,3-dimethyloxan-4-yl]carbamate |
| SMILES | C[C@H]1O[C@@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cc(C(=O)N(C)C)cc3F)n2)C[C@@H](NC(=O)OC(C)(C)C)[C@]1(C)O |
| InChI | InChI=1S/C32H36F3N5O6/c1-16-32(5,44)25(39-30(43)46-31(2,3)4)14-24(45-16)18-10-11-36-15-23(18)38-28(41)22-9-8-19(33)27(37-22)26-20(34)12-17(13-21(26)35)29(42)40(6)7/h8-13,15-16,24-25,44H,14H2,1-7H3,(H,38,41)(H,39,43)/t16-,24-,25-,32-/m1/s1 |
| InChIKey | UPHGJVUWCRGOKV-KDYMROGCSA-N |
| XLogP | 5.01 |
| TPSA | 142.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.66 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |