C22H20ClF2N5O4 — CID 67208213
5-amino-N-[4-[(2R,4R,5S,6S)-6-(chloromethyl)-4,5-dihydroxyoxan-2-yl]-3-pyridinyl]-2-(2,6-difluorophenyl)pyrimidine-4-carboxamide (PubChem CID 67208213) has the molecular formula C22H20ClF2N5O4 and a molecular weight of 491.88 g/mol. Its IUPAC name is 5-amino-N-[4-[(2R,4R,5S,6S)-6-(chloromethyl)-4,5-dihydroxyoxan-2-yl]-3-pyridinyl]-2-(2,6-difluorophenyl)pyrimidine-4-carboxamide.
| Compound Name | 5-amino-N-[4-[(2R,4R,5S,6S)-6-(chloromethyl)-4,5-dihydroxyoxan-2-yl]-3-pyridinyl]-2-(2,6-difluorophenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 67208213 |
| Molecular Formula | C22H20ClF2N5O4 |
| Molecular Weight | 491.88 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 5-amino-N-[4-[(2R,4R,5S,6S)-6-(chloromethyl)-4,5-dihydroxyoxan-2-yl]-3-pyridinyl]-2-(2,6-difluorophenyl)pyrimidine-4-carboxamide |
| SMILES | Nc1cnc(-c2c(F)cccc2F)nc1C(=O)Nc1cnccc1[C@H]1C[C@@H](O)[C@H](O)[C@@H](CCl)O1 |
| InChI | InChI=1S/C22H20ClF2N5O4/c23-7-17-20(32)15(31)6-16(34-17)10-4-5-27-9-14(10)29-22(33)19-13(26)8-28-21(30-19)18-11(24)2-1-3-12(18)25/h1-5,8-9,15-17,20,31-32H,6-7,26H2,(H,29,33)/t15-,16-,17-,20+/m1/s1 |
| InChIKey | BCQMFMXCXCTUAT-VIPLHTEESA-N |
| XLogP | 2.44 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.88 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|