C12H15FN2O5 — CID 67208249
(2R,3S,4S,5R,6S)-5-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)oxane-3,4-diol (PubChem CID 67208249) has the molecular formula C12H15FN2O5 and a molecular weight of 286.26 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-5-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)oxane-3,4-diol.
| Compound Name | (2R,3S,4S,5R,6S)-5-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 67208249 |
| Molecular Formula | C12H15FN2O5 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | (2R,3S,4S,5R,6S)-5-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)oxane-3,4-diol |
| SMILES | C[C@H]1O[C@@H](c2ccncc2[N+](=O)[O-])[C@H](F)[C@@H](O)[C@]1(C)O |
| InChI | InChI=1S/C12H15FN2O5/c1-6-12(2,17)11(16)9(13)10(20-6)7-3-4-14-5-8(7)15(18)19/h3-6,9-11,16-17H,1-2H3/t6-,9+,10+,11-,12-/m1/s1 |
| InChIKey | CROFNQIJQFWRFZ-LTVFLDSHSA-N |
| XLogP | 0.90 |
| TPSA | 105.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|