About 4-[(2R,4R,6S)-4-amino-6-(1-fluoroethyl)oxan-2-yl]pyridin-3-amine
4-[(2R,4R,6S)-4-amino-6-(1-fluoroethyl)oxan-2-yl]pyridin-3-amine (PubChem CID 67208366) has the molecular formula C12H18FN3O
and a molecular weight of 239.29 g/mol. Its IUPAC name is 4-[(2R,4R,6S)-4-amino-6-(1-fluoroethyl)oxan-2-yl]pyridin-3-amine.
Molecular Properties
| Compound Name | 4-[(2R,4R,6S)-4-amino-6-(1-fluoroethyl)oxan-2-yl]pyridin-3-amine |
| PubChem CID | 67208366 |
| Molecular Formula | C12H18FN3O |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 4-[(2R,4R,6S)-4-amino-6-(1-fluoroethyl)oxan-2-yl]pyridin-3-amine |
| SMILES | CC(F)[C@@H]1C[C@H](N)C[C@H](c2ccncc2N)O1 |
| InChI | InChI=1S/C12H18FN3O/c1-7(13)11-4-8(14)5-12(17-11)9-2-3-16-6-10(9)15/h2-3,6-8,11-12H,4-5,14-15H2,1H3/t7?,8-,11-,12+/m0/s1 |
| InChIKey | ZQYRKLJPSPSGSH-HERBQRHASA-N |
| XLogP | 1.57 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2R,4R,6S)-4-amino-6-(1-fluoroethyl)oxan-2-yl]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R,4R,6S)-4-amino-6-(1-fluoroethyl)oxan-2-yl]pyridin-3-amine?
The IUPAC name of 4-[(2R,4R,6S)-4-amino-6-(1-fluoroethyl)oxan-2-yl]pyridin-3-amine (CID 67208366) is 4-[(2R,4R,6S)-4-amino-6-(1-fluoroethyl)oxan-2-yl]pyridin-3-amine.
What is the SMILES notation for 4-[(2R,4R,6S)-4-amino-6-(1-fluoroethyl)oxan-2-yl]pyridin-3-amine?
The canonical SMILES for 4-[(2R,4R,6S)-4-amino-6-(1-fluoroethyl)oxan-2-yl]pyridin-3-amine is CC(F)[C@@H]1C[C@H](N)C[C@H](c2ccncc2N)O1.
What is the InChIKey of 4-[(2R,4R,6S)-4-amino-6-(1-fluoroethyl)oxan-2-yl]pyridin-3-amine?
The InChIKey is ZQYRKLJPSPSGSH-HERBQRHASA-N. The full InChI is InChI=1S/C12H18FN3O/c1-7(13)11-4-8(14)5-12(17-11)9-2-3-16-6-10(9)15/h2-3,6-8,11-12H,4-5,14-15H2,1H3/t7?,8-,11-,12+/m0/s1.
What are the key properties of 4-[(2R,4R,6S)-4-amino-6-(1-fluoroethyl)oxan-2-yl]pyridin-3-amine?
4-[(2R,4R,6S)-4-amino-6-(1-fluoroethyl)oxan-2-yl]pyridin-3-amine has a molecular weight of 239.29 g/mol, XLogP of 1.57, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R,4R,6S)-4-amino-6-(1-fluoroethyl)oxan-2-yl]pyridin-3-amine is sourced from PubChem (CID 67208366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).