About 1-(1,6-diaminocyclohexa-2,4-dien-1-yl)oxyethanol
1-(1,6-diaminocyclohexa-2,4-dien-1-yl)oxyethanol (PubChem CID 67208919) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is 1-(1,6-diaminocyclohexa-2,4-dien-1-yl)oxyethanol.
Molecular Properties
| Compound Name | 1-(1,6-diaminocyclohexa-2,4-dien-1-yl)oxyethanol |
| PubChem CID | 67208919 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 1-(1,6-diaminocyclohexa-2,4-dien-1-yl)oxyethanol |
| SMILES | CC(O)OC1(N)C=CC=CC1N |
| InChI | InChI=1S/C8H14N2O2/c1-6(11)12-8(10)5-3-2-4-7(8)9/h2-7,11H,9-10H2,1H3 |
| InChIKey | RCXFYSISWNQKBR-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,6-diaminocyclohexa-2,4-dien-1-yl)oxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,6-diaminocyclohexa-2,4-dien-1-yl)oxyethanol?
The IUPAC name of 1-(1,6-diaminocyclohexa-2,4-dien-1-yl)oxyethanol (CID 67208919) is 1-(1,6-diaminocyclohexa-2,4-dien-1-yl)oxyethanol.
What is the SMILES notation for 1-(1,6-diaminocyclohexa-2,4-dien-1-yl)oxyethanol?
The canonical SMILES for 1-(1,6-diaminocyclohexa-2,4-dien-1-yl)oxyethanol is CC(O)OC1(N)C=CC=CC1N.
What is the InChIKey of 1-(1,6-diaminocyclohexa-2,4-dien-1-yl)oxyethanol?
The InChIKey is RCXFYSISWNQKBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2/c1-6(11)12-8(10)5-3-2-4-7(8)9/h2-7,11H,9-10H2,1H3.
What are the key properties of 1-(1,6-diaminocyclohexa-2,4-dien-1-yl)oxyethanol?
1-(1,6-diaminocyclohexa-2,4-dien-1-yl)oxyethanol has a molecular weight of 170.21 g/mol, XLogP of -0.55, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,6-diaminocyclohexa-2,4-dien-1-yl)oxyethanol is sourced from PubChem (CID 67208919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).