C7H9NOS — CID 67209126
5,6,7,7a-tetrahydro-4H-thieno[2,3-b]pyridin-2-one (PubChem CID 67209126) has the molecular formula C7H9NOS and a molecular weight of 155.22 g/mol. Its IUPAC name is 5,6,7,7a-tetrahydro-4H-thieno[2,3-b]pyridin-2-one.
| Compound Name | 5,6,7,7a-tetrahydro-4H-thieno[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 67209126 |
| Molecular Formula | C7H9NOS |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.04 |
| IUPAC Name | 5,6,7,7a-tetrahydro-4H-thieno[2,3-b]pyridin-2-one |
| SMILES | O=C1C=C2CCCNC2S1 |
| InChI | InChI=1S/C7H9NOS/c9-6-4-5-2-1-3-8-7(5)10-6/h4,7-8H,1-3H2 |
| InChIKey | OJQOXGXUGLADIE-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|