About 1-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-piperidin-3-ylpropan-2-ol
1-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-piperidin-3-ylpropan-2-ol (PubChem CID 67209131) has the molecular formula C26H49NO2
and a molecular weight of 407.68 g/mol. Its IUPAC name is 1-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-piperidin-3-ylpropan-2-ol.
Molecular Properties
| Compound Name | 1-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-piperidin-3-ylpropan-2-ol |
| PubChem CID | 67209131 |
| Molecular Formula | C26H49NO2 |
| Molecular Weight | 407.68 g/mol |
| Exact Mass | 407.38 |
| IUPAC Name | 1-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-piperidin-3-ylpropan-2-ol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOCC(O)CC1CCCNC1 |
| InChI | InChI=1S/C26H49NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-29-24-26(28)22-25-19-18-20-27-23-25/h6-7,9-10,25-28H,2-5,8,11-24H2,1H3/b7-6-,10-9- |
| InChIKey | QCBCNCRSQICGBR-HZJYTTRNSA-N |
| XLogP | 6.57 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.68 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-piperidin-3-ylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-piperidin-3-ylpropan-2-ol?
The IUPAC name of 1-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-piperidin-3-ylpropan-2-ol (CID 67209131) is 1-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-piperidin-3-ylpropan-2-ol.
What is the SMILES notation for 1-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-piperidin-3-ylpropan-2-ol?
The canonical SMILES for 1-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-piperidin-3-ylpropan-2-ol is CCCCC/C=C\C/C=C\CCCCCCCCOCC(O)CC1CCCNC1.
What is the InChIKey of 1-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-piperidin-3-ylpropan-2-ol?
The InChIKey is QCBCNCRSQICGBR-HZJYTTRNSA-N. The full InChI is InChI=1S/C26H49NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-29-24-26(28)22-25-19-18-20-27-23-25/h6-7,9-10,25-28H,2-5,8,11-24H2,1H3/b7-6-,10-9-.
What are the key properties of 1-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-piperidin-3-ylpropan-2-ol?
1-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-piperidin-3-ylpropan-2-ol has a molecular weight of 407.68 g/mol, XLogP of 6.57, 19 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-piperidin-3-ylpropan-2-ol is sourced from PubChem (CID 67209131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).